CymitQuimica logo

CAS 408335-66-0

:

2(1H)-Quinolinone,3-hydroxy-6-methyl-

Description:
2(1H)-Quinolinone, 3-hydroxy-6-methyl- is an organic compound characterized by a quinolinone structure, which is a bicyclic compound containing a fused benzene and pyridine ring. This specific compound features a hydroxyl group (-OH) at the 3-position and a methyl group (-CH3) at the 6-position of the quinolinone ring. It is typically a crystalline solid and may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to biological activity. Additionally, it may serve as a precursor or intermediate in the synthesis of other chemical entities. As with many quinolinone derivatives, it may exhibit a range of pharmacological properties, making it a subject of research in various fields, including drug development and materials science.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(12)10(13)11-8/h2-5,12H,1H3,(H,11,13)
InChI key:HHBIREFHPDVOQC-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)NC(=O)C(=C2)O
Synonyms:
  • 2(1H)-Quinolinone,3-hydroxy-6-methyl-(9CI)
Found 2 products.