CymitQuimica logo

CAS 408502-23-8

:

3-Hydroxy-2,3-dimethylbutan-2-yl hydrogen (2-methoxypyridin-4-yl)boronate

Description:
3-Hydroxy-2,3-dimethylbutan-2-yl hydrogen (2-methoxypyridin-4-yl)boronate, with the CAS number 408502-23-8, is a boronate ester that features a boron atom bonded to a hydroxyl group and an organic moiety derived from 2-methoxypyridine. This compound is characterized by its boron-containing functional group, which is known for its reactivity in various organic transformations, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling. The presence of the 2-methoxypyridinyl group contributes to its potential as a ligand in coordination chemistry and may enhance its solubility and stability in organic solvents. Additionally, the branched alkyl chain, specifically the 3-hydroxy-2,3-dimethylbutan-2-yl group, may influence the steric and electronic properties of the molecule, affecting its reactivity and interactions with other chemical species. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals and materials science.
Formula:C12H20BNO4
InChI:InChI=1/C12H20BNO4/c1-11(2,15)12(3,4)18-13(16)9-6-7-14-10(8-9)17-5/h6-8,15-16H,1-5H3
InChI key:RLHAGSICYJAHMN-UHFFFAOYSA-N
SMILES:CC(C)(C(C)(C)OB(c1ccnc(c1)OC)O)O
Synonyms:
  • 2-Methoxypyridine-4-boronicacidpinacolester
  • 2-Methoxylypyrinine-4-Boronic Acid Pinacolate
  • 2-Methoxylypyridine-4-Boronic Acid Pinacolate
Found 5 products.