CAS 40851-62-5
:Methyl o-tolylacetate
Description:
Methyl o-tolylacetate, with the CAS number 40851-62-5, is an organic compound belonging to the ester functional group. It is characterized by its pleasant, fruity aroma, making it useful in the fragrance and flavoring industries. The compound is formed through the esterification reaction between o-tolyl alcohol and acetic acid, resulting in a structure that includes both aromatic and aliphatic components. Methyl o-tolylacetate is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water while being more soluble in organic solvents such as ethanol and ether. Its boiling point and density are consistent with those of similar esters, and it is generally stable under standard conditions. However, like many esters, it may undergo hydrolysis in the presence of strong acids or bases. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes. Overall, methyl o-tolylacetate is valued for its aromatic properties and potential applications in various industrial sectors.
Formula:C10H12O2
InChI:InChI=1/C10H12O2/c1-8-5-3-4-6-9(8)7-10(11)12-2/h3-6H,7H2,1-2H3
SMILES:Cc1ccccc1CC(=O)OC
Synonyms:- Methyl 2-methylphenylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzeneacetic acid, 2-methyl-, methyl ester
CAS:Formula:C10H12O2Purity:95%Color and Shape:LiquidMolecular weight:164.2011Methyl 2-(o-tolyl)acetate
CAS:Methyl 2-(o-tolyl)acetateFormula:C10H12O2Purity:95%Molecular weight:164.2Methyl 2-(o-tolyl)acetate
CAS:Methyl 2-(o-tolyl)acetate is a methylester that is used in organic chemistry as a pharmacophore. It is synthesized by the acylation reaction of chlorobenzene and formyl chloride in the presence of methanol. The product can be hydrolyzed to methyl 2-(o-tolyl)acrylate with an alkali metal hydroxide or ammonia, or it can undergo formylation with triazolinone to yield methyl 3-(o-tolyl)propionate. Methyl 2-(o-tolyl)acetate has been shown to react with metal cations such as copper(II) and mercury(II). This product is also stable isotope labeled for use as a tracer in biological studies.
Formula:C10H12O2Purity:Min. 95%Molecular weight:164.2 g/mol




