CymitQuimica logo

CAS 40932-60-3

:

2,3,5-Trichloro-6-hydroxybenzoic acid

Description:
2,3,5-Trichloro-6-hydroxybenzoic acid is an aromatic compound characterized by the presence of three chlorine atoms and a hydroxyl group attached to a benzoic acid framework. The chlorine substituents are located at the 2, 3, and 5 positions of the benzene ring, while the hydroxyl group is at the 6 position, contributing to its acidic properties. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits strong acidity due to the carboxylic acid functional group, which can donate protons in solution. The presence of multiple chlorine atoms enhances its reactivity and may influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential applications in research related to environmental chemistry and toxicology, particularly in studies concerning chlorinated compounds. Safety precautions should be taken when handling this substance due to its potential toxicity and environmental impact.
Formula:C7H3Cl3O3
InChI:InChI=1S/C7H3Cl3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13)
InChI key:InChIKey=IIHCUZVBIMTHEB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C(Cl)=CC(Cl)=C1O
Synonyms:
  • 2,3,5-Trichloro-6-Hydroxybenzoate
  • 2,3,5-Trichloro-6-Hydroxybenzoic Acid
  • 3,5,6-Trichloro-2-hydroxybenzoic acid
  • Benzoic acid, 2,3,5-trichloro-6-hydroxy-
  • Salicylic acid, 3,5,6-trichloro-
  • 3,5,6-Trichlorosalicylic acid
Found 8 products.