CAS 40951-69-7

Taxiresinol

Description:

Taxiresinol, with the CAS number 40951-69-7, is a naturally occurring lignan compound primarily found in various plant species, particularly in the Taxus genus, which includes yew trees. This compound is characterized by its complex polyphenolic structure, which contributes to its biological activity. Taxiresinol exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential anti-inflammatory and anticancer effects, making it of interest in pharmacological research. The compound is typically soluble in organic solvents and has limited solubility in water, which is common for many lignans. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, taxiresinol represents a significant area of study in natural product chemistry and its potential applications in health and medicine.

Formula: C₁₉H₂₂O₆

InChI: InChI=1S/C19H22O6/c1-24-18-7-11(2-4-16(18)22)6-13-10-25-19(14(13)9-20)12-3-5-15(21)17(23)8-12/h2-5,7-8,13-14,19-23H,6,9-10H2,1H3/t13-,14-,19+/m0/s1

InChI key: InChIKey=SNZZAHRDXCGWEM-CKFHNAJUSA-N

SMILES: C(O)[C@@H]1[C@H](OC[C@@H]1CC2=CC(OC)=C(O)C=C2)C3=CC(O)=C(O)C=C3

Synonyms:

• 1,2-Benzenediol, 4-[(2S,3R,4R)-tetrahydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)-2-furanyl]-
• (+)-Taxiresinol
• Taxiresinol
• 4-[(2S,3R,4R)-Tetrahydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)-2-furanyl]-1,2-benzenediol

Taxiresinol

CAS: 40951-69-7

Taxiresinol shows anticancer, antinociceptive, and antiallergic activities, it shows inhibitory activity on induced histamine release from the human basophilic

Formula: C₁₉H₂₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 346.37

Ref: TM-TMA0627

Taxiresinol

CAS: 40951-69-7

Formula: C₁₉H₂₂O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 346.379

Ref: BP-SBP02398

Taxiresinol

CAS: 40951-69-7

Taxiresinol is a complex lignan, which is a type of natural product derived predominantly from plant sources. Found in several species of coniferous trees, it is specifically abundant in the heartwood of Taxus (yew) species. As a plant-derived compound, Taxiresinol exhibits various biological activities due to its unique chemical structure.

Formula: C₁₉H₂₂O₆

Purity: Min. 95%

Molecular weight: 346.4 g/mol

Ref: 3D-QBA95169