CymitQuimica logo

CAS 40972-86-9

:

2,3-Dimethoxyphenylboronic acid

Description:
2,3-Dimethoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two methoxy substituents at the 2 and 3 positions. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the methoxy groups can influence the electronic properties of the phenyl ring, enhancing its reactivity and selectivity in chemical reactions. 2,3-Dimethoxyphenylboronic acid is also studied for its potential applications in drug development and materials science due to its unique structural features and reactivity. Safety precautions should be taken when handling this compound, as with all boronic acids, due to potential irritant properties.
Formula:C8H11BO4
InChI:InChI=1/C8H11BO4/c1-12-7-5-3-4-6(9(10)11)8(7)13-2/h3-5,10-11H,1-2H3
InChI key:VREWSCMOGIXMDQ-UHFFFAOYSA-N
SMILES:COc1cccc(c1OC)B(O)O
Synonyms:
  • 2,3-Dimethoxybenzeneboronic Acid
  • Akos Brn-0202
  • 2,3-Dimethoxyphenylboronci Acid
  • (2,3-Dimethoxyphenyl)Boronic Acid
Found 7 products.