CymitQuimica logo

CAS 41034-52-0

:

1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

Description:
1,2,3,4-Tetrahydroisoquinoline-1-carboxylic acid is a bicyclic organic compound characterized by its tetrahydroisoquinoline structure, which consists of a fused isoquinoline ring system with a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. It is known for its potential biological activities, including neuroprotective and analgesic properties, making it of interest in medicinal chemistry. The compound's structure allows for various chemical modifications, which can enhance its pharmacological profile. Additionally, it may serve as a precursor in the synthesis of more complex molecules or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and reactivity can vary based on concentration and exposure.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9/h1-4,9,11H,5-6H2,(H,12,13)
InChI key:OXFGRWIKQDSSLY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)CCNC2C(=O)O
Synonyms:
  • 1-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-
  • 1,2,3,4-Tetrahydro-Isoquinoline-1-Carboxylic Acid
  • 1,2,3,4-Tetrahydroisoquinoline-1-carboxylic acid
Found 4 products.