CymitQuimica logo

CAS 410522-18-8

:

1-butyl-3-methylimidazolium tosylate

Description:
1-Butyl-3-methylimidazolium tosylate is an ionic liquid characterized by its unique combination of a butyl and a methyl group attached to the imidazolium ring, along with a tosylate anion. This compound is typically colorless to pale yellow and exhibits a low vapor pressure, making it an attractive alternative to traditional solvents in various chemical processes. Its ionic nature contributes to its high thermal stability and excellent solvation properties, particularly for polar and ionic compounds. The presence of the butyl group enhances its hydrophobic characteristics, while the tosylate anion provides good ionic conductivity. This substance is often utilized in applications such as electrochemistry, catalysis, and as a solvent for organic reactions, owing to its ability to dissolve a wide range of materials. Additionally, it is considered environmentally friendly compared to conventional solvents, as it can be designed to be less volatile and more biodegradable. Overall, 1-butyl-3-methylimidazolium tosylate exemplifies the versatility and utility of ionic liquids in modern chemistry.
Formula:C15H22N2O3S
InChI:InChI=1S/C8H15N2.C7H8O3S/c1-3-4-5-10-7-6-9(2)8-10;1-6-2-4-7(5-3-6)11(8,9)10/h6-8H,3-5H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1
InChI key:VWFZFKKEKWMXIA-UHFFFAOYSA-M
SMILES:CCCCN1C=C[N+](=C1)C.CC1=CC=C(C=C1)S(=O)(=O)[O-]
Found 5 products.