CymitQuimica logo

CAS 412336-07-3

:

4-Benzofuranamine

Description:
4-Benzofuranamine, identified by its CAS number 412336-07-3, is an organic compound characterized by the presence of a benzofuran moiety attached to an amine group. This compound typically exhibits a fused bicyclic structure, which combines a benzene ring with a furan ring, contributing to its unique chemical properties. The amine functional group imparts basicity and potential reactivity, allowing for various interactions in chemical reactions, such as nucleophilic substitutions. 4-Benzofuranamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and solvent. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and π-π stacking interactions, which can influence its behavior in biological systems. Overall, 4-Benzofuranamine is a compound of interest due to its structural features and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c9-7-2-1-3-8-6(7)4-5-10-8/h1-5H,9H2
InChI key:OCZGGFAZAPGFMC-UHFFFAOYSA-N
SMILES:C1=CC(=C2C=COC2=C1)N
Synonyms:
  • 4-Aminobenzofuran
  • Benzofuran-4-Amine
  • 1-Benzofuran-4-Amine
  • Benzofuran-4-Ylamine
Found 4 products.