CAS 41288-96-4
:2-Chloro-5-Hydroxypyridine
Description:
2-Chloro-5-hydroxypyridine is an organic compound characterized by a pyridine ring substituted with a chlorine atom at the second position and a hydroxyl group at the fifth position. Its molecular formula is C5H5ClN2O, indicating the presence of carbon, hydrogen, chlorine, nitrogen, and oxygen. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active compounds. The presence of both the chlorine and hydroxyl groups contributes to its reactivity, making it a useful building block in organic synthesis. Additionally, 2-chloro-5-hydroxypyridine may exhibit specific solubility characteristics in polar solvents due to the hydroxyl group, while the chlorine atom can influence its electronic properties and interactions with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H4ClNO
InChI:InChI=1/C5H4ClNO/c6-5-2-1-4(8)3-7-5/h1-3,8H
SMILES:c1cc(Cl)ncc1O
Synonyms:- 2-Chloro-5-pyridinol
- 6-Chloropyridin-3-ol
- 6-Chloro-3-pyridinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Chloro-5-hydroxypyridine
CAS:Formula:C5H4ClNOPurity:>97.0%(GC)(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:129.542-Chloro-5-hydroxypyridine
CAS:Formula:C5H4ClNOPurity:97%Color and Shape:SolidMolecular weight:129.54442-Chloro-5-hydroxypyridine
CAS:2-Chloro-5-hydroxypyridineFormula:C5H4ClNOPurity:98%Color and Shape:Yellow-brown SolidMolecular weight:129.544362-Chloro-5-hydroxypyridine
CAS:2-Chloro-5-hydroxypyridine is a chemical that binds to the acetylcholine receptor, which is a protein on the surface of cells. 2-Chloro-5-hydroxypyridine has been shown to have antinociceptive properties in animals and may be effective in relieving pain. This chemical is also an inhibitor of enzyme activity, including aminopeptidase, carboxypeptidase, and dipeptidase. 2-Chloro-5-hydroxypyridine has been shown to inhibit the growth of cancer cells by binding to the α subunit of protein kinase C (PKC). The gene product for PKCα is histidine rich and can be synthesized chemically. 2-Chloro-5-hydroxypyridine also inhibits glutamate release from nerve terminals by blocking NMDA receptors.Formula:C5H4ClNOPurity:Min. 95%Color and Shape:PowderMolecular weight:129.54 g/mol2-Chloro-5-hydroxypyridine
CAS:Formula:C5H4ClNOPurity:95%Color and Shape:SolidMolecular weight:129.54






