CAS 41332-24-5

Piperazine, 1-(diphenylmethyl)-4-(1-oxo-3,3-diphenylpropyl)-

Description:

Piperazine, 1-(diphenylmethyl)-4-(1-oxo-3,3-diphenylpropyl)-, identified by CAS number 41332-24-5, is a chemical compound that belongs to the piperazine class, characterized by a six-membered ring containing two nitrogen atoms. This specific compound features a diphenylmethyl group and a ketone moiety, contributing to its unique structural and functional properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of multiple aromatic rings suggests potential for significant π-π interactions, which can influence its reactivity and interactions with biological targets. Piperazine derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The compound may exhibit various biological activities, although specific data on its efficacy and safety profile would require further investigation. As with many piperazine derivatives, it may also be of interest in the development of pharmaceuticals or agrochemicals, depending on its specific properties and interactions.

Formula: C₃₂H₃₂N₂O

InChI: InChI=1S/C32H32N2O/c35-31(25-30(26-13-5-1-6-14-26)27-15-7-2-8-16-27)33-21-23-34(24-22-33)32(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,30,32H,21-25H2

InChI key: VCPMZDWBEWTGNW-UHFFFAOYSA-N

SMILES: C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)CC(C4=CC=CC=C4)C5=CC=CC=C5

NP118809

CAS: 41332-24-5

Formula: C₃₂H₃₂N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 460.6093

Ref: IN-DA00C6GU

NP118809

CAS: 41332-24-5

NP118809

Formula: C₃₂H₃₂N₂O

Purity: ≥95%

Molecular weight: 460.61

Ref: 54-BUP16864

NP118809

CAS: 41332-24-5

NP118809 (39-1B4) is a potent N-type calcium channel blocker(IC50 : 0.11 μM).

Formula: C₃₂H₃₂N₂O

Purity: 97.74% - 98.12%

Color and Shape: Solid

Molecular weight: 460.61

Ref: TM-T7334

1-[4-(DIPHENYLMETHYL)-1-PIPERAZINYL]-3,3-DIPHENYL-1-PROPANONE

CAS: 41332-24-5

Purity: 98%

Molecular weight: 460.6210022

Ref: 10-F805314