CAS 41339-61-1

1H-Indole-3-ethanol, 5-(phenylmethoxy)-

Description:

1H-Indole-3-ethanol, 5-(phenylmethoxy)-, identified by CAS number 41339-61-1, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of an ethanol group at the 3-position and a phenylmethoxy group at the 5-position of the indole ring. The indole moiety is known for its biological significance, often serving as a core structure in various natural products and pharmaceuticals. The phenylmethoxy substituent can influence the compound's solubility, reactivity, and potential biological activity. Generally, compounds like this may exhibit properties such as antioxidant, anti-inflammatory, or neuroprotective effects, although specific biological activities would depend on further empirical studies. Additionally, the presence of both hydrophilic (ethanol) and hydrophobic (phenyl) groups suggests that this compound may have interesting interactions in biological systems, making it a candidate for further research in medicinal chemistry and drug development.

Formula: C₁₇H₁₇NO₂

InChI: InChI=1S/C17H17NO2/c19-9-8-14-11-18-17-7-6-15(10-16(14)17)20-12-13-4-2-1-3-5-13/h1-7,10-11,18-19H,8-9,12H2

InChI key: SQAUQUOZCKVQND-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3CCO

5-Benzyloxytryptophol-α,α,β,β-d4

CAS: 41339-61-1, 75238-47-0

Purity: 99 atom % D

Color and Shape: Off White To Brown Solid

Molecular weight: 271.35

Ref: 3U-D7286

5-Benzyloxytryptophol

CAS: 41339-61-1

5-Benzyloxytryptophol is a natural product that belongs to the indole compounds group. It is isolated from the pineal gland of cows and has been shown to be a potent serotonin receptor agonist, which may lead to its use in the treatment of sleep disorders. The structure of 5-Benzyloxytryptophol has been determined by spectroscopic data and X-ray crystallography. The molecule is homodimeric, with each monomer consisting of an indole ring fused to a benzene ring. The molecule also exhibits structural similarity with melatonin and 5-methoxytryptophol, which are also found in the pineal gland.

Formula: C₁₇H₁₇NO₂

Purity: Min. 90%

Molecular weight: 267.32 g/mol

Ref: 3D-FB52371