CAS 41340-78-7
:N,N-dimethylpiperazine-1-carboxamide
Description:
N,N-Dimethylpiperazine-1-carboxamide is an organic compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its polar nature and potential solubility in polar solvents. The presence of two methyl groups attached to the nitrogen atoms enhances its basicity and can influence its interaction with biological systems. Typically, compounds like N,N-dimethylpiperazine-1-carboxamide are studied for their potential applications in pharmaceuticals, particularly as intermediates or active pharmaceutical ingredients due to their ability to interact with biological targets. The compound may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, it may participate in hydrogen bonding due to the amide group, affecting its reactivity and stability. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C7H15N3O
InChI:InChI=1/C7H15N3O/c1-9(2)7(11)10-5-3-8-4-6-10/h8H,3-6H2,1-2H3
SMILES:CN(C)C(=O)N1CCNCC1
Synonyms:- 1-Piperazinecarboxamide, N,N-dimethyl-
- Piperazine-1-carboxylic acid, dimethylamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N,N-Dimethylpiperazine-1-carboxamide
CAS:N,N-Dimethylpiperazine-1-carboxamideFormula:C7H15N3OPurity:≥95%Color and Shape:SolidMolecular weight:157.21349PIPERAZINE-1-CARBOXYLIC ACID DIMETHYLAMIDE
CAS:Formula:C7H15N3OPurity:95%Color and Shape:SolidMolecular weight:157.2135Piperazine-1-carboxylic acid dimethylamide
CAS:Formula:C7H15N3OPurity:95%Color and Shape:Liquid, OilMolecular weight:157.217piperazine-1-carboxylic acid dimethylamide
CAS:Piperazine-1-carboxylic acid dimethylamide (PCA) is a 6-membered nitrogen heterocycle that belongs to the group of benzene, furan, and morpholine derivatives. It is an anti-inflammatory agent that blocks the H3 receptor in the central nervous system. PCA has been shown to inhibit abnormal cell growth in cancer cells. PCA inhibits histamine release from mast cells and thiomorpholine release from macrophages, which may be due to its ability to block the H3 receptor.Formula:C7H15N3OPurity:Min. 95%Molecular weight:157.21 g/mol



