CymitQuimica logo

CAS 41354-48-7

:

Aluminum, (glycinato-N,O)dihydroxy-, hydrate, (T-4)-

Description:
Aluminum, (glycinato-N,O)dihydroxy-, hydrate, commonly referred to by its CAS number 41354-48-7, is a coordination compound that features aluminum as the central metal ion coordinated to glycine, an amino acid that acts as a bidentate ligand. This compound typically exhibits a hydrated form, indicating the presence of water molecules in its structure, which can influence its solubility and stability. The glycinato ligands provide both nitrogen and oxygen donor sites, allowing for the formation of stable chelate complexes. This compound is often studied for its potential applications in pharmaceuticals, particularly in drug delivery systems and as an adjuvant in vaccines due to its biocompatibility and ability to enhance immune responses. Additionally, the presence of hydroxyl groups contributes to its reactivity and interaction with biological systems. Overall, the unique coordination chemistry and hydration characteristics of this aluminum complex make it a subject of interest in both inorganic chemistry and medicinal applications.
Formula:C2H6AlNO4·xH2O
InChI:InChI=1S/C2H5NO2.Al.3H2O/c3-1-2(4)5;;;;/h1,3H2,(H,4,5);;3*1H2/q;+3;;;/p-3
InChI key:InChIKey=UTUUIUQHGDRVPU-UHFFFAOYSA-K
SMILES:[OH-][Al+3]1([OH-])[O-]C(=O)C[NH2]1.O
Synonyms:
  • Aluminum, (glycinato-N,O)dihydroxy-, hydrate, (T-4)-
  • Dihydroxyaluminum aminoacetate hydrate
  • Aluminum, dihydroxy(glycinato)-, hydrate
Found 1 products.