CAS 41429-52-1

(1R,4aR,6S,8aR)-8a,9,9-trimethyl-4a,5,6,7,8,8a-hexahydro-1,6-methanonaphthalen-1(2H)-ol

Formula: C₁₄H₂₂O

InChI: InChI=1S/C14H22O/c1-12(2)10-6-8-13(3)11(9-10)5-4-7-14(12,13)15/h4-5,10-11,15H,6-9H2,1-3H3

InChI key: InChIKey=OSQSDJNIURJARY-UHFFFAOYSA-N

SMILES: CC12C3(O)C(C)(C)C(CC1C=CC3)CC2

(+)-Norpatchoulenol

Controlled Product

CAS: 41429-52-1

(+)-Norpatchoulenol is a sesquiterpene alcohol, which is a type of naturally occurring organic compound. It is primarily sourced from essential oils of various plants, particularly those in the Patchouli family. The compound is characterized by its three isoprene units that make up the foundational structure of sesquiterpenes, contributing to its aromatic properties.The mode of action of (+)-Norpatchoulenol primarily involves interactions with biological membranes and modulation of receptor activities, which can influence various biological pathways. Its specific interactions at the molecular level can result in effects such as anti-inflammatory and antimicrobial activities, although detailed mechanistic studies are still required to fully elucidate its pharmacodynamics.In terms of applications, (+)-Norpatchoulenol has garnered interest for its potential pharmacological properties. Its bioactivity suggests possible uses in therapeutic settings, particularly in the development of new anti-inflammatory or antimicrobial treatments. Additionally, its fragrance and stability make it a candidate for incorporation into cosmetics and personal care products, where both functional and aromatic qualities are desired. Research continues into its broader spectrum of biological effects and potential integration into novel pharmaceutical formulations.

Formula: C₁₄H₂₂O

Purity: Min. 95%

Molecular weight: 206.32 g/mol

Ref: 3D-FN162420