CAS 41546-34-3
:muco-Inositol
Description:
Muco-Inositol, with the CAS number 41546-34-3, is a stereoisomer of inositol, a cyclic sugar alcohol that plays a crucial role in cellular signaling and metabolism. It is characterized by its six-membered carbon ring, which contains six hydroxyl (–OH) groups, making it a polyol. Muco-Inositol is particularly noted for its involvement in various biological processes, including insulin signaling and cell membrane formation. It is often found in plant sources and is recognized for its potential health benefits, including its role in supporting metabolic health and possibly aiding in conditions like polycystic ovary syndrome (PCOS). The compound is typically soluble in water, which facilitates its biological activity. Additionally, muco-Inositol is considered a non-toxic substance, making it suitable for dietary supplementation. Its structural similarity to other inositol isomers allows it to participate in similar biochemical pathways, contributing to its importance in nutrition and health sciences.
Formula:C6H12O6
InChI:InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5+,6+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1R,2R,3S,4R,5r,6S)-cyclohexane-1,2,3,4,5,6-hexaol
CAS:(1R,2R,3S,4R,5r,6S)-cyclohexane-1,2,3,4,5,6-hexaolFormula:C6H12O6Purity:≥95%Molecular weight:180.16muco-Inositol
CAS:Formula:C6H12O6Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:180.16D-muco-Inositol
CAS:D-Mucinol is an inositol that is structurally similar to scyllo-inositol. It has been shown to inhibit the growth of cancer cells and also inhibits the release of calcium ions from the mitochondria, which may be due to its ability to inhibit polymerase chain reaction. D-Mucinol is a potential treatment for ovarian cancer and other cancers. D-Mucinol is a dinucleotide phosphate that binds with guanine nucleotides on DNA, inhibiting transcriptional elongation by binding to the RNA polymerase II enzyme. This prevents the production of mRNA, inhibiting protein synthesis and leading to cell death. D-Mucinol has been shown to have cytostatic effects against HL60 cells in vitro, which are thought to be related to its ability to inhibit mononucleotide phosphates, including p-nitrophenyl phosphate (PNPP), at high concentrations. D-MucinFormula:C6H12O6Purity:Min. 95%Molecular weight:180.16 g/mol




