CAS 41600-14-0
:N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-L-gamma-glutamyl-L-gamma-glutamyl-L-glutamic acid
Description:
N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-L-gamma-glutamyl-L-gamma-glutamyl-L-glutamic acid, with CAS number 41600-14-0, is a complex organic compound characterized by its multi-functional structure. It features a pteridine moiety, which is indicative of its potential biological activity, particularly in relation to folate metabolism and cellular processes. The presence of multiple glutamic acid residues suggests that it may play a role in peptide interactions and could be involved in various biochemical pathways. This compound is likely to exhibit solubility in polar solvents due to its amino acid components, and its structure may confer specific binding properties to biological targets. Additionally, the presence of amino groups indicates potential for protonation under physiological conditions, which could influence its reactivity and interaction with other biomolecules. Overall, this compound's intricate structure suggests it may have applications in medicinal chemistry, particularly in the development of targeted therapies or as a biochemical probe.
Formula:C30H36N10O11
InChI:InChI=1/C30H36N10O11/c1-40(13-15-12-33-25-23(34-15)24(31)38-30(32)39-25)16-4-2-14(3-5-16)26(45)37-19(29(50)51)7-10-21(42)35-17(27(46)47)6-9-20(41)36-18(28(48)49)8-11-22(43)44/h2-5,12,17-19H,6-11,13H2,1H3,(H,35,42)(H,36,41)(H,37,45)(H,43,44)(H,46,47)(H,48,49)(H,50,51)(H4,31,32,33,38,39)/t17-,18-,19-/m0/s1
SMILES:CN(Cc1cnc2c(c(N)[nH]c(=N)n2)n1)c1ccc(cc1)C(=O)N[C@@H](CCC(=N[C@@H](CCC(=N[C@@H](CCC(=O)O)C(=O)O)O)C(=O)O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methotrexate Triglutamate
CAS:Methotrexate Triglutamate (MTXPG3) has potential anti-inflammatory activity and can be used to study arthritis and lupus erythematosus.Formula:C30H36N10O11Purity:>99.99%Color and Shape:SolidMolecular weight:712.67Methotrexate-d3 Triglutamate Trifluoroacetate
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Methotrexate-d3 Triglutamate is the isotope labelled analog of Methotrexate Triglutamate (M260725); a metabolite of Methotrexate (M260675) which is a folic acid antagonist, antineoplastic, and antirheumatic.<br>References Freeman, M.V., J. Pharmacol. Exp. Ther., 122, 154 (1958); Weinblass, M.E., et al.: N. Engl. J. Med., 312, 818 (1985)<br></p>Formula:C30H33D3N10O11(C2HF3O2)xColor and Shape:NeatMolecular weight:715.69Methotrexate Triglutamate Trifluoroacetate
CAS:Controlled Product<p>Applications Methotrexate Triglutamate is a metabolite of Methotrexate (M260675); a folic acid antagonist, antineoplastic, and antirheumatic.<br>References Freeman, M.V., J. Pharmacol. Exp. Ther., 122, 154 (1958); Weinblass, M.E., et al.: N. Engl. J. Med., 312, 818 (1985)<br></p>Formula:C30H36N10O11xC2HF3O2Color and Shape:NeatMolecular weight:712.67



