CymitQuimica logo

CAS 432545-63-6

:

L-Glutamic acid,N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methyl-d3-amino]benzoyl]- (9CI)

Description:
L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methyl-d3-amino]benzoyl]- (9CI), with the CAS number 432545-63-6, is a synthetic compound that features a complex structure incorporating both amino acid and pteridine moieties. As a derivative of L-glutamic acid, it retains the characteristic carboxylic acid and amino functional groups, which contribute to its solubility in water and its role in biological systems. The presence of the pteridine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. This compound may exhibit properties such as being a substrate or inhibitor in enzymatic reactions, and its structural modifications could influence its binding affinity and selectivity towards biological targets. Additionally, the incorporation of deuterium (d3) in its structure may enhance its stability and alter its metabolic profile. Overall, this compound represents a unique intersection of amino acid chemistry and heterocyclic compounds, making it of interest in both research and therapeutic contexts.
Formula:C20H19D3N8O5
InChI:InChI=1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/t13-/m0/s1/i1D3
InChI key:FBOZXECLQNJBKD-FUPFOCIHSA-N
SMILES:[2H]C([2H])([2H])N(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O
Synonyms:
  • Methotrexate-D3
Found 18 products.