CymitQuimica logo

CAS 416852-69-2

:

2-Methyl-2-propanyl 4-{2-[methoxy(methyl)amino]-2-oxoethyl}-1-piperidinecarboxylate

Description:
2-Methyl-2-propanyl 4-{2-[methoxy(methyl)amino]-2-oxoethyl}-1-piperidinecarboxylate, identified by its CAS number 416852-69-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring and various functional groups such as an ester and an amine. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, reflecting its polar and non-polar characteristics due to the presence of both hydrophilic and hydrophobic groups. The methoxy and methylamino substituents contribute to its reactivity and potential biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, it is essential to handle it with care, following appropriate safety protocols due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential uses in various chemical and biological contexts.
Formula:C14H26N2O4
InChI:InChI=1S/C14H26N2O4/c1-14(2,3)20-13(18)16-8-6-11(7-9-16)10-12(17)15(4)19-5/h11H,6-10H2,1-5H3
InChI key:VOUMNMSUVOACEZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)CC(=O)N(C)OC
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-[2-(methoxymethylamino)-2-oxoethyl]-, 1,1-dimethylethyl ester
  • 1-Boc-4-[(N-Methoxy-N-MethylcarbaMoyl)Methyl]piperidine
Found 3 products.