CAS 41708-93-4: Chitotriose
Description:Chitotriose is a carbohydrate composed of three N-acetylglucosamine (GlcNAc) units linked by β(1→4) glycosidic bonds. It is a derivative of chitin, a biopolymer found in the exoskeletons of crustaceans and the cell walls of fungi. Chitotriose is a white, crystalline powder that is soluble in water, reflecting its polysaccharide nature. It plays a significant role in biological processes, particularly in the immune response, as it can be recognized by specific receptors in the human body, such as the chitinase-like proteins. This recognition can trigger immune responses, making chitotriose of interest in research related to allergies and infections. Additionally, chitotriose can serve as a substrate for various enzymes, including chitinases, which break down chitin and its derivatives. Its CAS number, 41708-93-4, is a unique identifier that facilitates the cataloging and study of this compound in scientific literature and databases. Overall, chitotriose is an important oligosaccharide with implications in both biochemistry and medicine.
Formula:C18H35N3O13
InChI:InChI=1S/C18H35N3O13/c19-5(1-22)11(27)15(6(26)2-23)33-18-10(21)14(30)16(8(4-25)32-18)34-17-9(20)13(29)12(28)7(3-24)31-17/h1,5-18,23-30H,2-4,19-21H2/t5-,6+,7+,8+,9+,10+,11+,12+,13+,14+,15+,16+,17-,18-/m0/s1
InChI key:InChIKey=HBAVVSYNWHLVDB-UDAFUQIYSA-N
SMILES:O=CC(N)C(O)C(OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2N)C(O)C1N)C(O)CO
- Synonyms:
- D-Glucose, O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-2-amino-2-deoxy-
- Chitotriose
- O-2-Amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-2-amino-2-deoxy-D-glucose
