CAS 41731-83-3
:Ethyl 2-bromothiazole-5-carboxylate
Description:
Ethyl 2-bromothiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a bromine atom at the 2-position of the thiazole ring and an ethyl ester functional group at the carboxylate position (5-position). The presence of the bromine substituent enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. Ethyl 2-bromothiazole-5-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions in biological systems, which can be explored for pharmacological properties. Additionally, the compound's reactivity can facilitate further derivatization, making it a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic compounds.
Formula:C6H6BrNO2S
InChI:InChI=1/C6H6BrNO2S/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3
SMILES:CCOC(=O)c1cnc(Br)s1
Synonyms:- Ethyl 2-bromo-5-thiazolecarboxylate
- Ethyl 2-Bromo-1,3-Thiazole-5-Carboxylate
- 2-Bromo-Thiazole-5-Carboxylic Acid Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2-bromothiazole-5-carboxylate, 98%
CAS:Ethyl 2-bromothiazole-5-carboxylate is used in medicine, pharmaceutical intermediate This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / itemFormula:C6H6BrNO2SPurity:98%Molecular weight:236.08Ethyl 2-bromothiazole-5-carboxylate
CAS:Formula:C6H6BrNO2SPurity:97%Color and Shape:LiquidMolecular weight:236.0863Ethyl 2-bromo-1,3-thiazole-5-carboxylate
CAS:Ethyl 2-bromo-1,3-thiazole-5-carboxylateFormula:C6H6BrNO2SPurity:98%Color and Shape:LiquidMolecular weight:236.086342-Bromo-thiazole-5-carboxylic acid ethyl ester
CAS:Formula:C6H6BrNO2SPurity:97%Color and Shape:LiquidMolecular weight:236.08



