CAS 417716-92-8: Lenvatinib
Description:Lenvatinib is a small molecule tyrosine kinase inhibitor primarily used in the treatment of certain types of cancer, including thyroid cancer and renal cell carcinoma. It works by inhibiting multiple receptor tyrosine kinases involved in tumor growth and angiogenesis, such as VEGFR, FGFR, PDGFR, and RET. Lenvatinib is characterized by its chemical formula, which reflects its complex structure, and it typically appears as a white to off-white solid. The substance has a moderate solubility in organic solvents and is generally administered orally in capsule form. Its pharmacokinetics indicate a relatively long half-life, allowing for once-daily dosing. Lenvatinib's efficacy is often evaluated in clinical settings, where it has shown significant improvements in progression-free survival compared to placebo in various studies. However, like many cancer therapies, it may be associated with side effects, including hypertension, fatigue, and gastrointestinal disturbances. Overall, lenvatinib represents a targeted therapeutic approach in oncology, reflecting advancements in personalized medicine.
Formula:C21H19ClN4O4
InChI:InChI=1S/C21H19ClN4O4/c1-29-19-10-17-13(9-14(19)20(23)27)18(6-7-24-17)30-12-4-5-16(15(22)8-12)26-21(28)25-11-2-3-11/h4-11H,2-3H2,1H3,(H2,23,27)(H2,25,26,28)
InChI key:InChIKey=WOSKHXYHFSIKNG-UHFFFAOYSA-N
SMILES:O=C(N)C1=CC=2C(=NC=CC2OC3=CC=C(NC(=O)NC4CC4)C(Cl)=C3)C=C1OC
- Synonyms:
- 4-[3-Chloro-4-(cyclopropylaminocarbonyl)aminophenoxy]-7-methoxy-6-quinolinecarboxamide
- 4-[3-Chloro-4-[[(cyclopropylamino)carbonyl]amino]phenoxy]-7-methoxy-6-quinolinecarboxamide
- 4-{3-Chloro-4-[(Cyclopropylcarbamoyl)Amino]Phenoxy}-7-Methoxyquinoline-6-Carboxamide
- 6-Quinolinecarboxamide, 4-[3-chloro-4-[[(cyclopropylamino)carbonyl]amino]phenoxy]-7-methoxy-
- E 7080
- Er 203492-00
- Lenvanix
- Lenvatinib