CymitQuimica logo

CAS 41805-36-1

:

1-(1-piperidin-1-ylcyclohexyl)methanamine

Description:
1-(1-Piperidin-1-ylcyclohexyl)methanamine, also known by its CAS number 41805-36-1, is a chemical compound characterized by its unique structure that includes a piperidine ring and a cyclohexyl group. This compound is classified as an amine due to the presence of an amine functional group (-NH2) attached to a cyclohexyl moiety. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound exhibits basic properties, which is common for amines, and can participate in various chemical reactions, including alkylation and acylation. Its solubility in organic solvents is generally good, while its solubility in water may vary. 1-(1-Piperidin-1-ylcyclohexyl)methanamine has potential applications in medicinal chemistry and pharmacology, particularly in the development of psychoactive substances or as intermediates in the synthesis of more complex molecules. However, safety and handling precautions should be observed due to its biological activity and potential toxicity.
Formula:C12H24N2
InChI:InChI=1/C12H24N2/c13-11-12(7-3-1-4-8-12)14-9-5-2-6-10-14/h1-11,13H2
InChI key:OHGRMGNDTSKKJV-UHFFFAOYSA-N
SMILES:C1CCC(CC1)(CN)N1CCCCC1
Synonyms:
  • 1-[1-(Piperidin-1-yl)cyclohexyl]methanamine
  • Cyclohexanemethanamine, 1-(1-piperidinyl)-
Found 3 products.