
CAS 41859-56-7
:[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenyl] 4-chlorobenzoate
Description:
The chemical substance known as [4-[2-[(4-chlorobenzoyl)amino]ethyl]phenyl] 4-chlorobenzoate, with the CAS number 41859-56-7, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. It features a chlorobenzoyl moiety, indicating the presence of chlorine substituents that can influence its reactivity and biological activity. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which may affect its solubility in organic solvents compared to water. Its potential applications could span various fields, including pharmaceuticals, where it may serve as an intermediate in drug synthesis or as a bioactive agent. The presence of the amine and ester functional groups suggests that it may participate in various chemical reactions, such as acylation or nucleophilic substitutions. Additionally, the chlorinated aromatic rings may impart specific electronic properties, influencing its interaction with biological targets or materials. Overall, this compound's unique structure positions it as a potentially valuable substance in chemical research and application.
Formula:C22H17Cl2NO3
InChI:InChI=1S/C22H17Cl2NO3/c23-18-7-3-16(4-8-18)21(26)25-14-13-15-1-11-20(12-2-15)28-22(27)17-5-9-19(24)10-6-17/h1-12H,13-14H2,(H,25,26)
InChI key:IFDVUUIJCJJBGN-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1CCNC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl
Synonyms:- Benzoic acid, 4-chloro-, 4-[2-[(4-chlorobenzoyl)amino]ethyl]phenyl ester
- Bezafibrate Impurity
- [4-[2-[(4-chlorobenzoyl)amino]ethyl]phenyl] 4-chlorobenzoate
- Bezafibrate Impurity 1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Bezafibrate Impurity 1
CAS:Formula:C22H17Cl2NO3Color and Shape:White To Off-White SolidMolecular weight:414.28N,O-Bis-(4-chlorobenzoyl)tyramine
CAS:Controlled ProductFormula:C22H17Cl2NO3Color and Shape:NeatMolecular weight:414.28N,O-Bis-(4-chlorobenzoyl)tyramine
CAS:Formula:C22H17Cl2NO3Color and Shape:NeatMolecular weight:414.28



