CAS 4188-88-9
:methyl (2E)-4-oxopent-2-enoate
Description:
Methyl (2E)-4-oxopent-2-enoate, with the CAS number 4188-88-9, is an organic compound characterized by its functional groups, including a methyl ester and a ketone. It features a conjugated system due to the presence of a double bond between the second and third carbon atoms, contributing to its reactivity and potential for undergoing various chemical transformations. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, indicative of its ester nature. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water. Methyl (2E)-4-oxopent-2-enoate is often utilized in organic synthesis, particularly in the production of more complex molecules, and may serve as an intermediate in various chemical reactions, including Michael additions and aldol condensations. Its reactivity and structural features make it a valuable compound in the field of organic chemistry and materials science. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C6H8O3
InChI:InChI=1/C6H8O3/c1-5(7)3-4-6(8)9-2/h3-4H,1-2H3/b4-3+
Synonyms:- 2-pentenoic acid, 4-oxo-, methyl ester, (2E)-
- 2-Pentenoic acid, 4-oxo-, methyl ester, (E)-
- Methyl (2E)-4-oxo-2-pentenoate
- Methyl 4-oxo-2-pentenoate
- Methyl (2E)-4-oxopent-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl Acetylacrylate
CAS:Formula:C6H8O3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:128.13Acetylacrylic acid methyl ester
CAS:Acetylacrylic acid methyl esterFormula:C6H8O3Purity:98%Molecular weight:128.12592



