CymitQuimica logo

CAS 4192-32-9

:

2-Thiophenecarboxylic acid, 5-(bromoacetyl)-, methyl ester

Description:
2-Thiophenecarboxylic acid, 5-(bromoacetyl)-, methyl ester is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of a bromoacetyl group at the 5-position of the thiophene ring introduces a bromine atom and an acetyl moiety, which can influence the compound's reactivity and polarity. Typically, such compounds exhibit moderate solubility in organic solvents and may have applications in pharmaceuticals or as intermediates in organic synthesis due to their functional groups. The presence of the bromine atom can also enhance electrophilic reactivity, making it useful in further chemical transformations. Overall, the compound's unique structure and functional groups contribute to its potential utility in various chemical applications.
Formula:C8H7BrO3S
InChI:InChI=1S/C8H7BrO3S/c1-12-8(11)7-3-2-6(13-7)5(10)4-9/h2-3H,4H2,1H3
InChI key:KKPYVZJBLYIYRX-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(S1)C(=O)CBr
Found 5 products.