CymitQuimica logo

CAS 42134-49-6

:

(Trimethylsilylpropargyl)triphenylphosphonium bromide

Description:
(Trimethylsilylpropargyl)triphenylphosphonium bromide is an organophosphorus compound characterized by the presence of a triphenylphosphonium cation and a trimethylsilylpropargyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The presence of the triphenylphosphonium moiety contributes to its stability and reactivity, making it useful in various organic synthesis applications, particularly in the formation of carbon-carbon bonds. The trimethylsilyl group enhances the compound's reactivity by providing a protective silyl group that can be removed under specific conditions, facilitating further transformations. The bromide counterion plays a crucial role in solubility and reactivity, often participating in nucleophilic substitution reactions. Overall, this compound is valued in synthetic organic chemistry for its ability to act as a phosphonium ylide precursor and in various coupling reactions, showcasing its versatility in the development of complex organic molecules.
Formula:C24H26BrPSi
InChI:InChI=1/C24H26PSi.BrH/c1-26(2,3)21-13-20-25(22-14-7-4-8-15-22,23-16-9-5-10-17-23)24-18-11-6-12-19-24;/h4-12,14-19H,20H2,1-3H3;1H/q+1;/p-1
InChI key:PBSHVEOONSKWJF-UHFFFAOYSA-M
SMILES:C[Si](C)(C)C#CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
Synonyms:
  • Triphenyl-[3-(trimethylsilyl)-2-propynyl]phosphonium bromide
  • (3-Trimethylsilyl-2-propynyl)triphenylphosphonium bromide
  • Triphenyl[3-(Trimethylsilyl)Prop-2-Yn-1-Yl]Phosphonium Bromide
Found 4 products.