CAS 421580-53-2

N-{2-[(5-chloro-2-methoxyphenyl)amino]-4'-methyl-4,5'-bi-1,3-thiazol-2'-yl}benzamide

Description:

N-{2-[(5-chloro-2-methoxyphenyl)amino]-4'-methyl-4,5'-bi-1,3-thiazol-2'-yl}benzamide, with CAS number 421580-53-2, is a synthetic organic compound characterized by its complex structure, which includes a benzamide moiety and a bi-thiazole unit. This compound features a chloro and methoxy substitution on the phenyl ring, contributing to its unique chemical properties. The presence of the thiazole rings suggests potential biological activity, as thiazoles are often found in pharmacologically active compounds. The compound's molecular structure indicates it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. As with many synthetic compounds, safety and handling precautions are essential, and its potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and efficacy. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₂₁H₁₇ClN₄O₂S₂

InChI: InChI=1/C21H17ClN4O2S2/c1-12-18(30-21(23-12)26-19(27)13-6-4-3-5-7-13)16-11-29-20(25-16)24-15-10-14(22)8-9-17(15)28-2/h3-11H,1-2H3,(H,24,25)(H,23,26,27)

InChI key: RDOBOPJBMQURAT-UHFFFAOYSA-N

SMILES: CC1=C(SC(=N1)NC(=O)C2=CC=CC=C2)C3=CSC(=N3)NC4=C(C=CC(=C4)Cl)OC

Synonyms:

• benzamide, N-[2-[(5-chloro-2-methoxyphenyl)amino]-4'-methyl[4,5'-bithiazol]-2'-yl]-

Corrector C4

CAS: 421580-53-2

Corrector C4

Formula: C₂₁H₁₇ClN₄O₂S₂

Purity: ≥98%

Molecular weight: 456.97

Ref: 54-BUP03602

Corrector C4

CAS: 421580-53-2

Ref: IN-DA00D7T0

N-[5-[2-(5-Chloro-2-methoxy-anilino)thiazol-4-yl]-4-methyl-thiazol-2-yl]benzamide

Controlled Product

CAS: 421580-53-2

Formula: C₂₁H₁₇ClN₄O₂S₂

Color and Shape: Neat

Molecular weight: 456.98

Ref: TR-N191045

Corrector C4

CAS: 421580-53-2

Corrector C4, a corrector commonly used to study cystic fibrosis mutants, works by alleviating the interaction between CFTR transmembrane domain mutants and

Formula: C₂₁H₁₇ClN₄O₂S₂

Purity: 99.98%

Color and Shape: Solid

Molecular weight: 456.97

Ref: TM-T31014