CymitQuimica logo

CAS 42164-79-4

:

hydroxy(3-nitrophenyl)acetic acid

Description:
Hydroxy(3-nitrophenyl)acetic acid, with the CAS number 42164-79-4, is an organic compound characterized by the presence of both a hydroxyl group and a nitro group attached to a phenyl ring, along with an acetic acid moiety. This compound typically exhibits properties associated with aromatic compounds, including stability and the potential for various chemical reactions due to the functional groups present. The hydroxyl group contributes to its solubility in polar solvents, while the nitro group can influence its reactivity and polarity. Hydroxy(3-nitrophenyl)acetic acid may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its structural features suggest that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point and boiling point. Additionally, the presence of the nitro group may impart specific biological activities, making it of interest in medicinal chemistry and related fields.
Formula:C8H7NO5
InChI:InChI=1/C8H7NO5/c10-7(8(11)12)5-2-1-3-6(4-5)9(13)14/h1-4,7,10H,(H,11,12)
InChI key:KNSULVUQBMUBCX-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N(=O)=O)C(C(=O)O)O
Synonyms:
  • 2-Hydroxy-2-(3-Nitrophenyl)Acetic Acid
Found 5 products.