CymitQuimica logo

CAS 422-03-7

:

2,2,3,3,3-Pentafluoropropylamine

Description:
2,2,3,3,3-Pentafluoropropylamine is a fluorinated organic compound characterized by its unique structure, which includes a propyl backbone substituted with five fluorine atoms and an amine functional group. This compound is typically a colorless liquid at room temperature and exhibits a high degree of volatility. Its significant fluorination imparts notable properties, such as high thermal stability and low surface tension, making it useful in various applications, including as a solvent or in the synthesis of fluorinated materials. The presence of the amine group allows for potential reactivity in organic synthesis, particularly in nucleophilic reactions. Additionally, 2,2,3,3,3-Pentafluoropropylamine is of interest in the field of materials science and pharmaceuticals due to its unique chemical properties. However, safety considerations are paramount, as fluorinated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal protocols are essential when working with this substance to mitigate any potential risks associated with its use.
Formula:C3H4F5N
InChI:InChI=1S/C3H4F5N/c4-2(5,1-9)3(6,7)8/h1,9H2
InChI key:InChIKey=DPQNQLKPUVWGHE-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(CN)(F)F
Synonyms:
  • 1-Propanamine, 2,2,3,3,3-pentafluoro-
  • 2,2,3,3,3-Pentafluoro-1-propanamine
  • 2,2,3,3,3-Pentafluoropropan-1-Amine
  • Propylamine, 2,2,3,3,3-pentafluoro-
  • 2,2,3,3,3-Pentafluoropropylamine
Found 5 products.