CAS 423-62-1: Perfluorodecyl iodide
Description:Perfluorodecyl iodide is a perfluorinated organic compound characterized by a long carbon chain fully substituted with fluorine atoms, specifically a decyl chain, and an iodine atom. Its molecular structure imparts unique properties, including high hydrophobicity and lipophobicity, making it resistant to water and oils. This compound is typically colorless to pale yellow and exhibits low volatility. Due to the presence of the iodine atom, it can participate in various chemical reactions, including nucleophilic substitutions. Perfluorodecyl iodide is often used in specialized applications such as surface modification, where its unique surface-active properties can enhance the performance of materials by imparting water-repellent characteristics. Additionally, it may serve as an intermediate in the synthesis of other fluorinated compounds. However, like many perfluorinated substances, it raises environmental and health concerns due to its persistence and potential bioaccumulation. Proper handling and disposal are essential to mitigate any risks associated with its use.
Formula:C10F21I
InChI:InChI=1S/C10F21I/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)32
InChI key:InChIKey=UDWBMXSQHOHKOI-UHFFFAOYSA-N
SMILES:FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I
- Synonyms:
- 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Heneicosafluoro-10-iododecane
- 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Henicosafluoro-10-iododecane
- 1-Iodoheneicosafluorodecane
- 1-Iodoperfluorodecane
- Decane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-10-iodo-
- Decane, heneicosafluoro-1-iodo-
- Heneicosafluoro-1-iododecane
- Perfluoro-1-iododecane
- Perfluorodecyl Iodide
