CAS 423-62-1
:Perfluorodecyl iodide
Description:
Perfluorodecyl iodide is a perfluorinated organic compound characterized by a long carbon chain fully substituted with fluorine atoms, specifically a decyl chain, and an iodine atom. Its molecular structure imparts unique properties, including high hydrophobicity and lipophobicity, making it resistant to water and oils. This compound is typically colorless to pale yellow and exhibits low volatility. Due to the presence of the iodine atom, it can participate in various chemical reactions, including nucleophilic substitutions. Perfluorodecyl iodide is often used in specialized applications such as surface modification, where its unique surface-active properties can enhance the performance of materials by imparting water-repellent characteristics. Additionally, it may serve as an intermediate in the synthesis of other fluorinated compounds. However, like many perfluorinated substances, it raises environmental and health concerns due to its persistence and potential bioaccumulation. Proper handling and disposal are essential to mitigate any risks associated with its use.
Formula:C10F21I
InChI:InChI=1S/C10F21I/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)32
InChI key:InChIKey=UDWBMXSQHOHKOI-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Heneicosafluoro-10-iododecane
- 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Henicosafluoro-10-iododecane
- 1-Iodoheneicosafluorodecane
- 1-Iodoperfluorodecane
- Decane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-10-iodo-
- Decane, heneicosafluoro-1-iodo-
- Heneicosafluoro-1-iododecane
- Perfluoro-1-iododecane
- Perfluorodecyl Iodide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Perfluoro-1-iododecane, 97%
CAS:Controlled ProductThis Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10F21IPurity:97%Color and Shape:Colorless to white, Crystals or powder or crystalline powderMolecular weight:645.98Perfluorodecyl iodide
CAS:Controlled ProductFormula:C10F21IPurity:97%Color and Shape:SolidMolecular weight:645.9779Henicosafluoro-10-iododecane
CAS:Controlled ProductHenicosafluoro-10-iododecane is a biochemical.Formula:C10F21IColor and Shape:SolidMolecular weight:645.98Perfluorodecyl iodide
CAS:Controlled ProductPerfluorodecyl iodideFormula:C10F21IPurity:98%Color and Shape:White SolidMolecular weight:645.97793Perfluoro-1-iododecane
CAS:Controlled ProductApplications Perfluorodecyl iodide is used to prepare 3,5-bis(perfluorodecyl)phenylboronic acid, "green" catalyst for the direct amide condensation reaction. It is also used to synthesize 3-(perfluorodecyl)prop-1-ene.
References Ishihara, K, et al.: Synlett., 9, 1371 (2001); Ryu, I., et al.: Tetrahedron Lett., 42, 947 (2001)Formula:C10F21IColor and Shape:NeatMolecular weight:645.978




