CAS 42333-78-8: 2,4,6-Tri-4-pyridinyl-1,3,5-triazine
Description:2,4,6-Tri-4-pyridinyl-1,3,5-triazine, with the CAS number 42333-78-8, is a heterocyclic organic compound characterized by its triazine core, which is substituted at the 2, 4, and 6 positions with pyridine rings. This compound exhibits notable properties such as high thermal stability and potential for coordination with metal ions, making it of interest in coordination chemistry and materials science. The presence of multiple nitrogen atoms in both the triazine and pyridine structures contributes to its ability to engage in hydrogen bonding and coordination interactions, enhancing its reactivity and solubility in polar solvents. Additionally, its unique electronic structure may impart interesting optical properties, which can be exploited in various applications, including organic electronics and photonic devices. The compound's synthesis typically involves multi-step reactions, and it may be utilized in research related to agrochemicals, pharmaceuticals, or as a ligand in catalysis. Overall, 2,4,6-Tri-4-pyridinyl-1,3,5-triazine is a versatile compound with significant potential in various scientific fields.
Formula:C18H12N6
InChI:InChI=1/C18H12N6/c1-7-19-8-2-13(1)16-22-17(14-3-9-20-10-4-14)24-18(23-16)15-5-11-21-12-6-15/h1-12H
- Synonyms:
- 1,3,5-Tris(4-pyridyl)-2,4,6-triazine
- 2,4,6-Tri(4-pyridyl)-1,3,5-triazine
- 2,4,6-Tri(Pyridin-4-Yl)-1,3,5-Triazine