CymitQuimica logo

CAS 423768-50-7

:

ethyl 5-(5-bromo-2-thienyl)-3-isoxazolecarboxylate

Description:
Ethyl 5-(5-bromo-2-thienyl)-3-isoxazolecarboxylate is a chemical compound characterized by its unique structure, which includes an ethyl ester group, a brominated thienyl moiety, and an isoxazole ring. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The isoxazole ring contributes to the compound's stability and potential for various chemical reactions, including nucleophilic substitutions. This compound may exhibit specific solubility properties depending on the solvent used, typically being more soluble in organic solvents due to its non-polar characteristics. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or antimicrobial properties. Additionally, the presence of the thienyl group may impart unique electronic properties, making it suitable for studies in organic electronics or as a building block in synthetic organic chemistry. Overall, ethyl 5-(5-bromo-2-thienyl)-3-isoxazolecarboxylate represents a versatile compound with potential applications across various fields of research.
Formula:C10H8BrNO3S
InChI:InChI=1/C10H8BrNO3S/c1-2-14-10(13)6-5-7(15-12-6)8-3-4-9(11)16-8/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cc(c2ccc(Br)s2)on1
Synonyms:
  • Ethyl 5-(5-Bromothiophen-2-Yl)Isoxazole-3-Carboxylate
Found 1 products.