CymitQuimica logo

CAS 423769-74-8

:

4-(1H-imidazol-1-yl)benzenecarbothioamide

Description:
4-(1H-imidazol-1-yl)benzenecarbothioamide, with the CAS number 423769-74-8, is a chemical compound characterized by its unique structural features, which include an imidazole ring and a thiocarbonamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the imidazole moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The thiocarbonamide group may influence the compound's reactivity and solubility, affecting its behavior in various chemical environments. Additionally, the compound's molecular structure may allow for hydrogen bonding and other intermolecular interactions, which can be significant in biological systems. Overall, 4-(1H-imidazol-1-yl)benzenecarbothioamide is a compound that may possess diverse applications, particularly in the fields of pharmaceuticals and agrochemicals, due to its potential biological activity and unique chemical properties.
Formula:C10H9N3S
InChI:InChI=1/C10H9N3S/c11-10(14)8-1-3-9(4-2-8)13-6-5-12-7-13/h1-7H,(H2,11,14)
InChI key:QUJXJNDFQWCYLF-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=S)N)n1ccnc1
Found 2 products.