CAS 42456-75-7
:1-(5-chloro-4-nitro-2-thienyl)ethan-1-one
Description:
1-(5-Chloro-4-nitro-2-thienyl)ethan-1-one, with the CAS number 42456-75-7, is an organic compound characterized by its thienyl structure, which incorporates a thiophene ring substituted with a chlorine atom and a nitro group. This compound typically exhibits a yellow to brown color and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the chloro and nitro substituents contributes to its reactivity, making it a useful building block in chemical reactions such as nucleophilic substitutions and coupling reactions. Additionally, the compound's molecular structure suggests it may possess certain biological activities, although specific biological properties would require further investigation. Its stability and solubility characteristics can vary depending on the solvent and conditions used, which are important factors to consider in practical applications. Overall, 1-(5-chloro-4-nitro-2-thienyl)ethan-1-one is a notable compound in the field of synthetic organic chemistry.
Formula:C6H4ClNO3S
InChI:InChI=1/C6H4ClNO3S/c1-3(9)5-2-4(8(10)11)6(7)12-5/h2H,1H3
SMILES:CC(=O)c1cc(c(Cl)s1)N(=O)=O
Synonyms:- 1-(5-Chloro-4-Nitrothiophen-2-Yl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Acetyl-2-chloro-3-nitrothiophene, tech
CAS:5-Acetyl-2-chloro-3-nitrothiophene, techFormula:C6H4ClNO3SPurity:95%Color and Shape:SolidMolecular weight:205.618861-(5-Chloro-4-nitrothiophen-2-yl)ethan-1-one
CAS:Formula:C6H4ClNO3SPurity:95%Color and Shape:SolidMolecular weight:205.61891-(5-chloro-4-nitrothiophen-2-yl)ethan-1-one
CAS:1-(5-chloro-4-nitrothiophen-2-yl)ethan-1-one is a thiophene that has shown to have pharmacological activity in animal models. It has been shown to be a bifunctional compound, with the ability to serve as an amine and an alcohol. This functional group makes 1-(5-chloro-4-nitrothiophen-2-yl)ethan-1-one useful in the synthesis of benzodiazepines, which are important drugs for the treatment of anxiety.Formula:C6H4ClNO3SPurity:Min. 95%Molecular weight:205.61 g/mol




