CAS 42522-59-8
:Methyl-d3-malonic Acid
Description:
Methyl-d3-malonic acid, with the CAS number 42522-59-8, is a deuterated form of malonic acid, which is a dicarboxylic acid. Its molecular structure features two carboxyl (-COOH) groups flanking a central carbon chain, with the methyl group (-CH3) being deuterated, meaning that the hydrogen atoms in the methyl group are replaced by deuterium isotopes. This substitution alters its physical properties slightly compared to its non-deuterated counterpart. Methyl-d3-malonic acid is typically used in various chemical synthesis processes, particularly in studies involving isotopic labeling, which can aid in tracing metabolic pathways or understanding reaction mechanisms. It is soluble in water and organic solvents, making it versatile for laboratory applications. The presence of deuterium can also influence the compound's NMR (nuclear magnetic resonance) characteristics, providing valuable information in analytical chemistry. Overall, methyl-d3-malonic acid serves as an important tool in both research and industrial applications, particularly in organic synthesis and metabolic studies.
Formula:C4H3D3O4
InChI:InChI=1/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8)/i1D3
SMILES:C(C(C(=O)O)C(=O)O)([2H])([2H])[2H]
Synonyms:- (2H3)methylpropanedioic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl-d3-malonic Acid
CAS:Formula:CD3CH(COOH)2Purity:99 atom % DColor and Shape:White SolidMolecular weight:121.04544Methylmalonic Acid-d3
CAS:Controlled ProductApplications An isotope labelled derivative of Methylmalonic Acid (M318860), binds with coenzyme A to form methylmalonyl-CoA, also a metabolic intermediate transformed to succinic acid (SA) by a vitamin B12-dependent catalytic step, and is broadly used as a clinical biomarker of functional vitamin B12 status.
References Pedersen, T., et al.: J. Chromatogr., B: Anal. Technol. Biomed. Life Sci., 879, 1502 (2011),Formula:C42H3H3O4Color and Shape:NeatMolecular weight:121.11
