CAS 4254-88-0
:(2S)-2-Aminooctanedioic acid
Description:
(2S)-2-Aminooctanedioic acid, also known as L-2-amino-8-octenedioic acid, is an amino acid characterized by its two carboxylic acid groups and an amino group, making it a dicarboxylic amino acid. It is a chiral compound, with the (2S) designation indicating the specific stereochemistry at the second carbon atom. This compound is typically found in a crystalline form and is soluble in water due to the presence of its polar functional groups. Its molecular structure allows it to participate in various biochemical processes, including protein synthesis and metabolic pathways. As an amino acid derivative, it can play a role in the synthesis of peptides and proteins. Additionally, it may exhibit biological activity, potentially influencing metabolic functions or serving as a precursor for other bioactive compounds. The compound's CAS number, 4254-88-0, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, (2S)-2-Aminooctanedioic acid is significant in both biochemical research and potential therapeutic applications.
Formula:C8H15NO4
InChI:InChI=1S/C8H15NO4/c9-6(8(12)13)4-2-1-3-5-7(10)11/h6H,1-5,9H2,(H,10,11)(H,12,13)/t6-/m0/s1
InChI key:InChIKey=YOFPFYYTUIARDI-LURJTMIESA-N
SMILES:C([C@@H](C(O)=O)N)CCCCC(O)=O
Synonyms:- (2S)-2-aminooctanedioic acid
- (S)-2-Aminooctanedioic acid
- <span class="text-smallcaps">L</span>-2-Aminosuberic acid
- <span class="text-smallcaps">L</span>-α-Aminosuberic acid
- H-Asu-Oh
- Octanedioic acid, 2-amino-, (2S)-
- Octanedioic acid, 2-amino-, (S)-
- Octanedioic acid, 2-amino-, <span class="text-smallcaps">L</span>-
- L-α-Aminosuberic acid
- Octanedioic acid, 2-amino-, L-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
H-Asu-OH
CAS:Bachem ID: 4017100.
Formula:C8H15NO4Purity:≥ 99%Color and Shape:White PowderMolecular weight:189.21(S)-2-Aminooctanedioic acid
CAS:(S)-2-Aminooctanedioic acidFormula:C8H15NO4Purity:95%Molecular weight:189.21L-α-Aminosuberic Acid
CAS:Controlled ProductApplications L-α-Aminosuberic Acid
Formula:C8H15NO4Color and Shape:NeatMolecular weight:189.209L-a-Aminosuberic acid
CAS:L-a-aminosuberic acid is a synthetic amino acid that has been used as an analog of L-cysteine. It can be used to induce tumor cell death by inhibiting the uptake of fatty acids in prostate cancer cells. L-a-aminosuberic acid is also able to inhibit the expression of proteins that are involved in prostate cancer, such as monoclonal antibodies and sequences. This compound may be a potential biomarker for the diagnosis of prostate cancer. The low expression levels may be due to the lack of disulfide bond formation, which is necessary for protein activity.Formula:C8H15NO4Purity:Min. 95%Molecular weight:189.21 g/mol





