CymitQuimica logo

CAS 42599-26-8

:

2,3-Pyrrolidinedione, 1-methyl-

Description:
2,3-Pyrrolidinedione, 1-methyl- is a chemical compound characterized by its cyclic structure, which includes a five-membered ring containing two carbonyl groups (C=O) and a nitrogen atom. This compound is a derivative of pyrrolidine, featuring a methyl group attached to the nitrogen atom. It typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. The presence of the carbonyl groups contributes to its reactivity, making it a potential intermediate in organic synthesis and a candidate for various chemical reactions, such as nucleophilic additions. Its molecular structure allows for hydrogen bonding, which can influence its solubility in polar solvents. Additionally, 2,3-Pyrrolidinedione, 1-methyl- may exhibit biological activity, although specific applications or effects would depend on further research. Safety data should be consulted, as with any chemical substance, to understand its handling and potential hazards.
Formula:C5H7NO2
InChI:InChI=1S/C5H7NO2/c1-6-3-2-4(7)5(6)8/h2-3H2,1H3
InChI key:DHFODCCTNFXCCQ-UHFFFAOYSA-N
SMILES:CN1CCC(=O)C1=O
Found 5 products.