CAS 426-58-4

Benzene, [(trifluoromethyl)sulfonyl]-

Description:

Benzene, [(trifluoromethyl)sulfonyl]- (CAS 426-58-4), is an aromatic compound characterized by the presence of a benzene ring substituted with a trifluoromethylsulfonyl group. This compound exhibits a distinct structure where the trifluoromethyl group (-CF3) is attached to a sulfonyl group (-SO2-), which in turn is linked to the benzene ring. The trifluoromethyl group contributes to the compound's high electronegativity and lipophilicity, influencing its reactivity and solubility in organic solvents. Benzene derivatives, including this compound, are known for their stability due to the resonance of the aromatic ring. The sulfonyl group enhances the compound's electrophilic character, making it useful in various chemical reactions, including sulfonation and nucleophilic substitution. Additionally, the presence of fluorine atoms can impart unique properties, such as increased thermal stability and altered polarity. Due to these characteristics, benzene, [(trifluoromethyl)sulfonyl]- may find applications in pharmaceuticals, agrochemicals, and materials science. However, handling and usage should be approached with caution due to potential toxicity and environmental concerns associated with fluorinated compounds.

Formula: C₇H₅F₃O₂S

InChI: InChI=1S/C7H5F3O2S/c8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-5H

InChI key: UPGBQYFXKAKWQC-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)S(=O)(=O)C(F)(F)F

Synonyms:

• Trifluoromethylsulfonylbenzene
• (Trifluoromethyl) phenyl sulfone

Phenyl Trifluoromethyl Sulfone

CAS: 426-58-4

Formula: C₇H₅F₃O₂S

Purity: >98.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 210.17

Ref: 3B-P2195

Phenyl trifluoromethyl sulphone

CAS: 426-58-4

Phenyl trifluoromethyl sulphone

Formula: C₇H₅F₃O₂S

Purity: >98%

Color and Shape: Liquid

Molecular weight: 210.1736

Ref: 54-PC49074

Phenyl Trifluoromethyl Sulfone

CAS: 426-58-4

Formula: C₇H₅F₃O₂S

Purity: 98%

Color and Shape: Liquid

Molecular weight: 210.1736

Ref: IN-DA00CLLJ

Phenyl Trifluoromethyl Sulfone

CAS: 426-58-4

Phenyl Trifluoromethyl Sulfone

Formula: C₇H₅F₃O₂S

Purity: 98%

Molecular weight: 210.17

Ref: IN-DG306308

Phenyl (trifluoromethyl)sulfone

CAS: 426-58-4

Formula: C₇H₅F₃O₂S

Purity: 97%

Color and Shape: Liquid

Molecular weight: 210.17

Ref: 10-F470987

Phenyl trifluoromethylsulfone

CAS: 426-58-4

Phenyl trifluoromethylsulfone is a sulfone with a hydroxy group. It is an extractant, used for the extraction of radionuclides such as strontium-90 and cesium-137. Phenyl trifluoromethylsulfone can be used to treat skin cancer, due to its ability to inhibit the growth of cells in the epidermis. The reaction starts with the formation of a phenol intermediate that reacts with a nucleophilic reagent (such as water) to form an acidic product and a phosphoric acid ester. The exothermic reaction causes heat production, which can lead to spontaneous combustion if there is insufficient ventilation. Phenyl trifluoromethylsulfone has been shown to be resistant to carbonyl compounds such as benzaldehyde, acetaldehyde and cyclohexanone.

Formula: C₇H₅F₃O₂S

Purity: Min. 95%

Color and Shape: Colorless Clear Liquid

Molecular weight: 210.17 g/mol

Ref: 3D-FP11234