CymitQuimica logo

CAS 4265-28-5

:

2-Chloro-1-ethenyl-2,3,3-trifluoro-1-methylcyclobutane

Description:
2-Chloro-1-ethenyl-2,3,3-trifluoro-1-methylcyclobutane, with the CAS number 4265-28-5, is a fluorinated organic compound characterized by its unique cyclobutane structure. This compound features a chlorine atom and multiple fluorine atoms attached to a cyclobutane ring, which contributes to its reactivity and potential applications in various chemical processes. The presence of the ethenyl group indicates that it has unsaturation, making it more reactive than saturated hydrocarbons. The trifluoromethyl groups enhance its stability and lipophilicity, which can influence its behavior in biological systems and its utility in synthetic chemistry. Additionally, the chlorine substituent can participate in nucleophilic substitution reactions, making this compound of interest in the development of pharmaceuticals and agrochemicals. Its physical properties, such as boiling point and solubility, would be influenced by the presence of these halogen substituents, which typically increase the compound's density and alter its volatility. Overall, this compound exemplifies the complexity and utility of halogenated organic molecules in modern chemistry.
Formula:C7H8ClF3
InChI:InChI=1S/C7H8ClF3/c1-3-5(2)4-6(9,10)7(5,8)11/h3H,1,4H2,2H3
InChI key:InChIKey=GNDCVAZGIZYWFY-UHFFFAOYSA-N
SMILES:C(=C)C1(C)C(Cl)(F)C(F)(F)C1
Synonyms:
  • 1,1,2-Trifluoro-2-chloro-3-methyl-3-vinylcyclobutane
  • 2-Chloro-1,1,2-trifluoro-3-methyl-3-vinylcyclobutane
  • Cyclobutane, 2-Chloro-1-Ethenyl-2,3,3-Trifluoro-1-Methyl-
  • Cyclobutane, 2-chloro-1,1,2-trifluoro-3-methyl-3-vinyl-
  • 2-Chloro-1-ethenyl-2,3,3-trifluoro-1-methylcyclobutane
Found 1 products.