CAS 42749-27-9
:3,6,9,12,15-pentaoxaheptadecane-1,17-diyl bis(4-methylbenzenesulfonate)
Description:
3,6,9,12,15-pentaoxaheptadecane-1,17-diyl bis(4-methylbenzenesulfonate), with the CAS number 42749-27-9, is a synthetic organic compound characterized by its unique structure that includes a long aliphatic chain interspersed with ether linkages and sulfonate groups. This compound features a heptadecane backbone with five ether (–O–) linkages, which contribute to its solubility and potential applications in various fields, including materials science and pharmaceuticals. The presence of bis(4-methylbenzenesulfonate) moieties enhances its reactivity and functionality, making it suitable for use as a surfactant or in polymer chemistry. Its sulfonate groups impart hydrophilicity, while the hydrophobic aliphatic chain provides amphiphilic properties, allowing it to interact with both polar and nonpolar environments. This compound may exhibit interesting properties such as thermal stability, low toxicity, and the ability to form micelles or vesicles in solution, which can be advantageous in drug delivery systems or as emulsifying agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C26H38O11S2
InChI:InChI=1/C26H38O11S2/c1-23-3-7-25(8-4-23)38(27,28)36-21-19-34-17-15-32-13-11-31-12-14-33-16-18-35-20-22-37-39(29,30)26-9-5-24(2)6-10-26/h3-10H,11-22H2,1-2H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1
Synonyms:- 3,6,9,12,15-Pentaoxaheptadecane-1,17-Diol, Bis(4-Methylbenzenesulfonate)
- 3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl bis(4-methylbenzenesulfonate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,6,9,12,15-Pentaoxaheptadecane-1,17-Diyl Bis(4-Methylbenzenesulfonate)
CAS:Formula:C26H38O11S2Purity:98%Color and Shape:SolidMolecular weight:590.7033Bis-Tos-PEG6
CAS:Bis-Tos-PEG6 is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C26H38O11S2Color and Shape:SolidMolecular weight:590.7Hexaethylene Glycol Di-p-toluenesulfonate
CAS:Formula:C26H38O11S2Purity:>95.0%(HPLC)(qNMR)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:590.70Bis-Tos-PEG6
CAS:3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl bis(4-methylbenzenesulfonate)Formula:C26H38O11S2Purity:98%Molecular weight:590.7Tos-PEG7-Tos
CAS:Tos-PEG7-TosFormula:C26H38O11S2Purity:>97%Color and Shape:LiquidMolecular weight:590.70332





