CymitQuimica logo

CAS 428-38-6

:

2,3-dihydrospiro[indene-1,4'-piperidine]

Description:
2,3-Dihydrospiro[indene-1,4'-piperidine] is a bicyclic compound characterized by its unique spiro structure, which consists of an indene moiety fused with a piperidine ring. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both carbon and nitrogen atoms. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound is generally a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties include the presence of functional groups that can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, 2,3-dihydrospiro[indene-1,4'-piperidine] may display interesting pharmacological activities, although specific biological data would depend on further research. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-2-4-12-11(3-1)5-6-13(12)7-9-14-10-8-13/h1-4,14H,5-10H2
InChI key:ZBYFQSPEUIVDTF-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)CCC12CCNCC1
Found 4 products.