CAS 4289-02-5
:4-[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]-L-phenylalanyl-N~5~-(diaminomethylidene)-L-ornithyl-L-tryptophan
Description:
The chemical substance known as "4-[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]-L-phenylalanyl-N~5~-(diaminomethylidene)-L-ornithyl-L-tryptophan," with the CAS number 4289-02-5, is a complex peptide that incorporates multiple amino acid residues and functional groups. This compound features a unique structure characterized by the presence of an imidazole ring, which is indicative of its potential biological activity, particularly in relation to enzyme interactions or receptor binding. The presence of the diaminomethylidene group suggests that it may participate in various biochemical pathways, possibly influencing metabolic processes. Its chiral centers, denoted by the L- and S- configurations, imply that it may exhibit specific stereochemical properties that can affect its biological function and interactions. As a peptide, it is likely soluble in polar solvents and may exhibit properties typical of amino acids and peptides, such as the ability to form hydrogen bonds and engage in ionic interactions. Overall, this compound's intricate structure positions it as a candidate for research in pharmacology and biochemistry.
Formula:C32H40N10O5
InChI:InChI=1/C32H40N10O5/c33-23(14-21-16-37-17-40-21)28(43)19-9-7-18(8-10-19)12-24(34)29(44)41-26(6-3-11-38-32(35)36)30(45)42-27(31(46)47)13-20-15-39-25-5-2-1-4-22(20)25/h1-2,4-5,7-10,15-17,23-24,26-27,39H,3,6,11-14,33-34H2,(H,37,40)(H,41,44)(H,42,45)(H,46,47)(H4,35,36,38)/t23-,24-,26-,27-/m0/s1
SMILES:c1ccc2c(c1)c(C[C@@H](C(=O)O)N=C([C@H](CCCNC(=N)N)N=C([C@H](Cc1ccc(cc1)C(=O)[C@H](Cc1cnc[nH]1)N)N)O)O)c[nH]2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Characteristic MSH-Tetrapeptide
CAS:The melanocortin-4 receptor (MC4R) is a G protein-coupled receptor that mediates the protective and cytoprotective activities of endogenous melanocortins. This receptor has been shown to be an important target for neuroprotective agents. The MC4R is expressed in the central nervous system, peripheral nervous system, and other tissues where it may have a role in regulating energy homeostasis. The N-terminal amino acid sequence of the human MC4R ligand is H-His-Phe-Arg-Trp-OH. This peptide has been shown to have potent agonist potency at the MC4R with a Kd of 0.2 nM and an EC50 of 2 nM.Formula:C32H40N10O5Purity:Min. 95%Molecular weight:644.72 g/molCharacteristic MSH-Tetrapeptide
CAS:Bachem ID: 4004112.
Formula:C32H40N10O5Color and Shape:BeigeMolecular weight:644.73

