CymitQuimica logo

CAS 42933-43-7

:

2,3-Dihydrobenzo[b]furan-5-ylamine

Description:
2,3-Dihydrobenzo[b]furan-5-ylamine, with the CAS number 42933-43-7, is an organic compound characterized by its unique bicyclic structure, which consists of a benzo[b]furan moiety fused to a five-membered ring. This compound features an amine functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the dihydrobenzo structure imparts certain physical properties, such as solubility in organic solvents and moderate stability under standard conditions. It may exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure allows for various substitution patterns, which can influence its chemical behavior and interactions. As with many amines, it may participate in hydrogen bonding and can act as a nucleophile in chemical reactions. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5H,3-4,9H2
InChI key:YJMADHMYUJFMQE-UHFFFAOYSA-N
SMILES:C1COC2=C1C=C(C=C2)N
Found 5 products.