CAS 4304-12-5
:benzyl B-D-glucopyranoside
Description:
Benzyl B-D-glucopyranoside is a glycoside compound characterized by the presence of a benzyl group attached to the anomeric carbon of a glucose molecule in its pyranose form. This compound is typically a white to off-white crystalline solid, soluble in polar organic solvents like methanol and ethanol, but less soluble in water due to its hydrophobic benzyl group. It is often used in biochemical research as a substrate for glycosylation reactions and as a building block in the synthesis of more complex carbohydrates. The compound exhibits properties typical of glycosides, including stability under acidic conditions but susceptibility to hydrolysis in the presence of strong acids or enzymes like glycosidases. Its structure allows for various applications in medicinal chemistry and carbohydrate chemistry, making it a valuable compound in the study of carbohydrate interactions and functions. Additionally, benzyl B-D-glucopyranoside can serve as a model compound for understanding the behavior of more complex glycosides in biological systems.
Formula:C13H18O6
InChI:InChI=1/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12-,13-/m1/s1
Synonyms:- Benzyl glucopyranoside
- benzyl beta-D-glucopyranoside
- Benzyl β-D-Glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
b-D-Glucopyranoside, phenylmethyl
CAS:Formula:C13H18O6Purity:%Color and Shape:SolidMolecular weight:270.2784Benzyl β-D-glucopyranoside
CAS:Benzyl β-D-glucopyranosideFormula:C13H18O6Color and Shape:SolidMolecular weight:270.27842Benzyl β-D-Glucopyranoside
CAS:Formula:C13H18O6Purity:>95.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:270.28Benzyl β-D-Glucopyranoside
CAS:Controlled ProductApplications Benzyl β-D-Glucopyranoside (cas# 4304-12-5) is a compound useful in organic synthesis.
References Yoshikawa, M., et al.: Chem. Pharm. Bull., 56, 1297 (2008), Takeda, Y., et al.: J. Nat. Med., 62, 476 (2008),Formula:C13H18O6Color and Shape:NeatMolecular weight:270.28Benzyl b-D-glucopyranoside
CAS:Benzyl b-D-glucopyranoside is an organic solvent that can be used in chromatography. It is a disaccharide that consists of benzyl alcohol and glucose. Benzyl b-D-glucopyranoside has been shown to have inhibitory activities against glycosidation and β-amyrin synthesis, as well as other biochemical techniques. This compound has also been shown to have carbohydrate antigen activity, which may be due to its benzyl group.Formula:C13H18O6Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:270.28 g/mol






