CymitQuimica logo

CAS 4304-12-5

:

benzyl B-D-glucopyranoside

Description:
Benzyl B-D-glucopyranoside is a glycoside compound characterized by the presence of a benzyl group attached to the anomeric carbon of a glucose molecule in its pyranose form. This compound is typically a white to off-white crystalline solid, soluble in polar organic solvents like methanol and ethanol, but less soluble in water due to its hydrophobic benzyl group. It is often used in biochemical research as a substrate for glycosylation reactions and as a building block in the synthesis of more complex carbohydrates. The compound exhibits properties typical of glycosides, including stability under acidic conditions but susceptibility to hydrolysis in the presence of strong acids or enzymes like glycosidases. Its structure allows for various applications in medicinal chemistry and carbohydrate chemistry, making it a valuable compound in the study of carbohydrate interactions and functions. Additionally, benzyl B-D-glucopyranoside can serve as a model compound for understanding the behavior of more complex glycosides in biological systems.
Formula:C13H18O6
InChI:InChI=1/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12-,13-/m1/s1
InChI key:GKHCBYYBLTXYEV-HENWMNBSSA-N
SMILES:C1=CC=C(C=C1)COC2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
Synonyms:
  • Benzyl glucopyranoside
  • benzyl beta-D-glucopyranoside
  • Benzyl β-D-Glucopyranoside
Found 8 products.