CymitQuimica logo

CAS 430459-57-7

:

(4Z)-4-(5-bromo-2-methoxybenzylidene)-2-(methylsulfanyl)-1,3-thiazol-5(4H)-one

Description:
The chemical substance known as (4Z)-4-(5-bromo-2-methoxybenzylidene)-2-(methylsulfanyl)-1,3-thiazol-5(4H)-one, with the CAS number 430459-57-7, is a thiazole derivative characterized by its unique structural features. It contains a thiazolone core, which is a five-membered heterocyclic ring containing sulfur and nitrogen atoms. The presence of a bromine atom and a methoxy group on the benzylidene moiety contributes to its potential reactivity and solubility properties. The methylsulfanyl group enhances its chemical diversity and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial or anticancer activities, although specific biological data may vary. Its structural complexity allows for various interactions with biological targets, making it a candidate for further research in drug development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of organic chemistry.
Formula:C12H10BrNO2S2
InChI:InChI=1/C12H10BrNO2S2/c1-16-10-4-3-8(13)5-7(10)6-9-11(15)18-12(14-9)17-2/h3-6H,1-2H3/b9-6-
SMILES:COc1ccc(cc1/C=C\1/C(=O)SC(=N1)SC)Br
Found 1 products.