CAS 43050-28-8
:1-(4-Methoxyphenyl)cyclopentanecarboxylic acid
Description:
1-(4-Methoxyphenyl)cyclopentanecarboxylic acid, with the CAS number 43050-28-8, is an organic compound characterized by its cyclopentane structure substituted with a carboxylic acid group and a para-methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The methoxy group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The compound may participate in various chemical reactions, such as esterification or amidation, due to the carboxylic acid functionality. Additionally, its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. The presence of the methoxy group can also affect the compound's electronic properties, potentially influencing its interactions in biological systems. Overall, 1-(4-Methoxyphenyl)cyclopentanecarboxylic acid is a versatile compound with characteristics that make it relevant in both research and application contexts.
Formula:C13H16O3
InChI:InChI=1S/C13H16O3/c1-16-11-6-4-10(5-7-11)13(12(14)15)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3,(H,14,15)
InChI key:InChIKey=OMMROWIAJMZSLF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCCC1)C2=CC=C(OC)C=C2
Synonyms:- 1-(4-Methoxyphenyl)Cyclopentanecarboxylic Acid
- 1-(4-Methoxyphenyl)cyclopentane-1-carboxylic acid
- 1-(p-Methoxyphenyl)cyclopentanecarboxylic acid
- Cyclopentanecarboxylic acid, 1-(4-methoxyphenyl)-
- NSC 155172
- 1-(4-Methoxyphenyl)-1-cyclopentanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(4-Methoxyphenyl)cyclopentanecarboxylic acid
CAS:1-(4-Methoxyphenyl)cyclopentanecarboxylic acidFormula:C13H16O3Purity:95%Molecular weight:220.264341-(4-methoxyphenyl)cyclopentane-1-carboxylic acid
CAS:Formula:C13H16O3Purity:97%Color and Shape:SolidMolecular weight:220.26431-(4-Methoxyphenyl)cyclopentanecarboxylic acid
CAS:1-(4-Methoxyphenyl)cyclopentanecarboxylic acid is a molecule that belongs to the class of primary alcohols. It is an organic compound with a molecular formula of CHOCOCH. The acid-catalyzed reaction of 1-(4-methoxyphenyl)cyclopentanecarboxylic acid with phenol in the presence of concentrated sulfuric acid produces 4-methoxybenzaldehyde. The frequency of this molecule was observed to be 3.2 x 10^5 Hz, which is higher than the frequency expected for amino acids, indicating that it has a lower molecular weight than amino acids.Formula:C13H16O3Purity:Min. 95%Molecular weight:220.26 g/mol



