CymitQuimica logo

CAS 43089-05-0

:

2,5-Oxazolidinedione, 4-(1-methylethyl)-, (4R)-

Description:
2,5-Oxazolidinedione, 4-(1-methylethyl)-, (4R)-, with the CAS number 43089-05-0, is a cyclic organic compound characterized by its oxazolidinedione structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits a chiral center at the 4-position, leading to specific stereochemical properties that can influence its reactivity and interactions with biological systems. It is often studied for its potential applications in pharmaceuticals and as a building block in organic synthesis due to its unique functional groups. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, which can affect solubility and permeability in biological contexts. Additionally, the oxazolidinedione moiety is known for its ability to participate in various chemical reactions, including cycloadditions and nucleophilic substitutions, making it a versatile compound in synthetic chemistry. Overall, this substance's structural features and stereochemistry play a crucial role in its chemical behavior and potential applications.
Formula:C6H9NO3
InChI:InChI=1S/C6H9NO3/c1-3(2)4-5(8)10-6(9)7-4/h3-4H,1-2H3,(H,7,9)/t4-/m1/s1
InChI key:XNCNNYXFGGTEMT-SCSAIBSYSA-N
SMILES:CC(C)[C@@H]1C(=O)OC(=O)N1
Found 4 products.