CymitQuimica logo

CAS 43157-23-9

:

(Deamino-Cys1,Val4,D-Arg8)-Vasopressin

Description:
(Deamino-Cys1,Val4,D-Arg8)-Vasopressin, also known as a synthetic analog of the natural hormone vasopressin, is a peptide that exhibits specific structural modifications to enhance its pharmacological properties. This compound is characterized by the substitution of the amino acids at positions 1, 4, and 8, which alters its receptor binding affinity and biological activity. The deamino modification at the first position removes an amino group, contributing to increased stability and resistance to enzymatic degradation. The valine at position 4 and the D-arginine at position 8 further enhance its potency and selectivity for vasopressin receptors, particularly the V1 and V2 subtypes. This peptide is primarily studied for its potential therapeutic applications in managing conditions such as diabetes insipidus and certain types of bleeding disorders. Its unique structure allows for improved pharmacokinetics, making it a valuable compound in both clinical and research settings. As with many peptides, its activity is closely related to its three-dimensional conformation, which is essential for receptor interaction and subsequent biological effects.
Formula:C46H65N13O11S2
InChI:InChI=1S/C46H65N13O11S2/c1-25(2)38-44(69)56-32(22-35(47)61)41(66)57-33(45(70)59-18-7-11-34(59)43(68)54-29(10-6-17-51-46(49)50)39(64)52-23-36(48)62)24-72-71-19-16-37(63)53-30(21-27-12-14-28(60)15-13-27)40(65)55-31(42(67)58-38)20-26-8-4-3-5-9-26/h3-5,8-9,12-15,25,29-34,38,60H,6-7,10-11,16-24H2,1-2H3,(H2,47,61)(H2,48,62)(H,52,64)(H,53,63)(H,54,68)(H,55,65)(H,56,69)(H,57,66)(H,58,67)(H4,49,50,51)/t29-,30+,31+,32+,33+,34+,38+/m1/s1
InChI key:KEBRFHAVFOSSOX-WSFLLCRESA-N
SMILES:CC(C)[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CSSCCC(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CC2=CC=CC=C2)CC3=CC=C(C=C3)O)C(=O)N4CCC[C@H]4C(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N)CC(=O)N
Synonyms:
  • 3-Mercaptopropionyl-Tyr-Phe-Val-Asn-Cys-Pro-D-Arg-Gly-NH2 (Disulfide bond)
Found 3 products.